|
CAS#: 19404-57-0 Product: 2,4-Dichloro-3-Methyl-1,5-Bis(2-Methyl-2-Propanyl)Benzene No suppilers available for the product. |
| Name | 2,4-Dichloro-3-Methyl-1,5-Bis(2-Methyl-2-Propanyl)Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H22Cl2 |
| Molecular Weight | 273.24 |
| CAS Registry Number | 19404-57-0 |
| SMILES | Clc1c(cc(c(Cl)c1C)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C15H22Cl2/c1-9-12(16)10(14(2,3)4)8-11(13(9)17)15(5,6)7/h8H,1-7H3 |
| InChIKey | CXRPXFZFGODPFD-UHFFFAOYSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.604°C at 760 mmHg (Cal.) |
| Flash point | 102.267°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-3-Methyl-1,5-Bis(2-Methyl-2-Propanyl)Benzene |