|
CAS#: 19423-03-1 Product: 2,4-Diethyl-1,2-Dihydro-2-Methylquinoline No suppilers available for the product. |
| Name | 2,4-Diethyl-1,2-Dihydro-2-Methylquinoline |
|---|---|
| Synonyms | Oprea1_807661; 2,4-Dmdq; Quinoline, 2,4-Diethyl-1,2-Dihydro-2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 |
| CAS Registry Number | 19423-03-1 |
| SMILES | C1=CC=CC2=C1C(=CC(N2)(CC)C)CC |
| InChI | 1S/C14H19N/c1-4-11-10-14(3,5-2)15-13-9-7-6-8-12(11)13/h6-10,15H,4-5H2,1-3H3 |
| InChIKey | WRGWVXRANTWQOG-UHFFFAOYSA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.01°C at 760 mmHg (Cal.) |
| Flash point | 139.77°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diethyl-1,2-Dihydro-2-Methylquinoline |