|
CAS#: 19456-83-8 Product: 4,4-Dimethylcholesta-8,14-Dien-3-Ol No suppilers available for the product. |
| Name | 4,4-Dimethylcholesta-8,14-Dien-3-Ol |
|---|---|
| Synonyms | (3S,5R,10S,13R,17R)-17-[(1R)-1,5-Dimethylhexyl]-4,4,10,13-Tetramethyl-1,2,3,5,6,7,11,12,16,17-Decahydrocyclopenta[A]Phenanthren-3-Ol; 4,4-Dcdo; 4,4-Dimethyl-5Alpha-Cholesta-8,14-Diene-3Beta-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 |
| CAS Registry Number | 19456-83-8 |
| SMILES | [C@]12([C@H](C([C@@H](O)CC1)(C)C)CCC3=C2CC[C@]4(C3=CC[C@@H]4[C@@H](CCCC(C)C)C)C)C |
| InChI | 1S/C29H48O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h13,19-20,22,25-26,30H,8-12,14-18H2,1-7H3/t20-,22-,25+,26+,28-,29-/m1/s1 |
| InChIKey | OGQJUYXFIOFTMA-PBJLWWPKSA-N |
| Density | 0.992g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.098°C at 760 mmHg (Cal.) |
| Flash point | 221.971°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethylcholesta-8,14-Dien-3-Ol |