|
CAS#: 19491-70-4 Product: (Z)-3-(Dimethoxyphosphinyloxy)-2-Butenoic Acid No suppilers available for the product. |
| Name | (Z)-3-(Dimethoxyphosphinyloxy)-2-Butenoic Acid |
|---|---|
| Synonyms | (E)-3-Dimethoxyphosphoryloxybut-2-Enoic Acid; Brn 2450212; Sd 4455 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11O6P |
| Molecular Weight | 210.12 |
| CAS Registry Number | 19491-70-4 |
| SMILES | C\C(O[P](OC)(OC)=O)=C/C(=O)O |
| InChI | 1S/C6H11O6P/c1-5(4-6(7)8)12-13(9,10-2)11-3/h4H,1-3H3,(H,7,8)/b5-4+ |
| InChIKey | SMKWBNVXDMCGRW-SNAWJCMRSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.871°C at 760 mmHg (Cal.) |
| Flash point | 118.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-3-(Dimethoxyphosphinyloxy)-2-Butenoic Acid |