|
CAS#: 1952-97-2 Product: Mecaphane No suppilers available for the product. |
| Name | Mecaphane |
|---|---|
| Synonyms | (2S)-2-Amino-3-[4-[Bis(2-Chloroethyl)Amino]-2-Methoxy-Phenyl]Propanoic Acid; (2S)-2-Amino-3-[4-[Bis(2-Chloroethyl)Amino]-2-Methoxy-Phenyl]Propionic Acid; Mecaphane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 |
| CAS Registry Number | 1952-97-2 |
| SMILES | [C@H](C(=O)O)(N)CC1=CC=C(C=C1OC)N(CCCl)CCCl |
| InChI | 1S/C14H20Cl2N2O3/c1-21-13-9-11(18(6-4-15)7-5-16)3-2-10(13)8-12(17)14(19)20/h2-3,9,12H,4-8,17H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | VKYIPXSTNJXGRF-LBPRGKRZSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.517°C at 760 mmHg (Cal.) |
| Flash point | 248.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mecaphane |