|
CAS#: 1953-89-5 Product: 2,6-Dichloro-N-(Hydroxymethyl)Thiobenzamide No suppilers available for the product. |
| Name | 2,6-Dichloro-N-(Hydroxymethyl)Thiobenzamide |
|---|---|
| Synonyms | 2,6-Dichloro-N-Methylol-Thiobenzamide; Nsc 143331; Th 073-H |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl2NOS |
| Molecular Weight | 236.12 |
| CAS Registry Number | 1953-89-5 |
| SMILES | C1=C(C(=C(C=C1)Cl)C(NCO)=S)Cl |
| InChI | 1S/C8H7Cl2NOS/c9-5-2-1-3-6(10)7(5)8(13)11-4-12/h1-3,12H,4H2,(H,11,13) |
| InChIKey | XRONASRTKCDKMP-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.426°C at 760 mmHg (Cal.) |
| Flash point | 168.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloro-N-(Hydroxymethyl)Thiobenzamide |