|
CAS#: 19573-10-5 Product: N(8)-Norphysostigmine No suppilers available for the product. |
| Name | N(8)-Norphysostigmine |
|---|---|
| Synonyms | N-Methylcarbamic Acid [(8Bs)-4,8B-Dimethyl-1,2,3,3A-Tetrahydropyrrolo[2,3-B]Indol-7-Yl] Ester; N8-Norphysostigmine; Pyrrolo(2,3-B)Indol-5-Ol, 1,2,3,3A,8,8A-Hexahydro-1,3A-Dimethyl-, Methylcarbamate (Ester), (3As-Cis)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 |
| CAS Registry Number | 19573-10-5 |
| SMILES | [C@@]12(C3=C(N(C1NCC2)C)C=CC(=C3)OC(=O)NC)C |
| InChI | 1S/C14H19N3O2/c1-14-6-7-16-12(14)17(3)11-5-4-9(8-10(11)14)19-13(18)15-2/h4-5,8,12,16H,6-7H2,1-3H3,(H,15,18)/t12?,14-/m0/s1 |
| InChIKey | DWMBEPKCENULIA-PYMCNQPYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.387°C at 760 mmHg (Cal.) |
| Flash point | 197.762°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(8)-Norphysostigmine |