|
CAS#: 19576-21-7 Product: 2,2-Dimethyl-1-[2-(2-Methyl-2-Propanyl)-2-Cyclopropen-1-Yl]-1-Propanone No suppilers available for the product. |
| Name | 2,2-Dimethyl-1-[2-(2-Methyl-2-Propanyl)-2-Cyclopropen-1-Yl]-1-Propanone |
|---|---|
| Synonyms | 1-(2-tert |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 19576-21-7 |
| SMILES | O=C(C1/C=C1/C(C)(C)C)C(C)(C)C |
| InChI | 1S/C12H20O/c1-11(2,3)9-7-8(9)10(13)12(4,5)6/h7-8H,1-6H3 |
| InChIKey | NQCHIAZTRFTROO-UHFFFAOYSA-N |
| Density | 0.941g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.101°C at 760 mmHg (Cal.) |
| Flash point | 83.885°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-1-[2-(2-Methyl-2-Propanyl)-2-Cyclopropen-1-Yl]-1-Propanone |