|
CAS#: 19618-30-5 Product: 3,3-Bis(4-Chlorophenyl)-1-(4-Methyl-1-Piperazinyl)-2-Propen-1-One No suppilers available for the product. |
| Name | 3,3-Bis(4-Chlorophenyl)-1-(4-Methyl-1-Piperazinyl)-2-Propen-1-One |
|---|---|
| Synonyms | 1-[3,3-Bis(4-chlorophenyl)acryloyl]-4-methylpiperazine # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.29 |
| CAS Registry Number | 19618-30-5 |
| SMILES | O=C(N1CCN(C)CC1)\C=C(/c2ccc(Cl)cc2)c3ccc(Cl)cc3 |
| InChI | 1S/C20H20Cl2N2O/c1-23-10-12-24(13-11-23)20(25)14-19(15-2-6-17(21)7-3-15)16-4-8-18(22)9-5-16/h2-9,14H,10-13H2,1H3 |
| InChIKey | SROAMJVVHOYPKJ-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.058°C at 760 mmHg (Cal.) |
| Flash point | 282.232°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Bis(4-Chlorophenyl)-1-(4-Methyl-1-Piperazinyl)-2-Propen-1-One |