|
CAS#: 19619-43-3 Product: Azelaic Acid Potassium Salt No suppilers available for the product. |
| Name | Azelaic Acid Potassium Salt |
|---|---|
| Synonyms | Potassium Azelaate; Azelaic Acid, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14KO4 |
| Molecular Weight | 225.31 |
| CAS Registry Number | 19619-43-3 |
| EINECS | 243-190-2 |
| SMILES | C(C([O-])=O)CCCCCCC([O-])=O.[K+] |
| InChI | 1S/C9H16O4.K/c10-8(11)6-4-2-1-3-5-7-9(12)13;/h1-7H2,(H,10,11)(H,12,13);/q;+1/p-2 |
| InChIKey | KYUUIPCDSNGPAU-UHFFFAOYSA-L |
| Boiling point | 370.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azelaic Acid Potassium Salt |