|
CAS#: 19633-95-5 Product: 5,7,22-Cholestatrien-3beta-Ol No suppilers available for the product. |
| Name | 5,7,22-Cholestatrien-3beta-Ol |
|---|---|
| Synonyms | (3S,9S,10R,13R,14R,17R)-17-[(E,1R)-1,5-Dimethylhex-2-Enyl]-10,13-Dimethyl-2,3,4,9,11,12,14,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; 5,7,22-Cholestatrien-3Beta-Ol; Cholesta-5,7,22-Trien-3-Ol, (3Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 |
| CAS Registry Number | 19633-95-5 |
| SMILES | [C@]34([C@H](C2=CC=C1C[C@@H](O)CC[C@@]1([C@H]2CC3)C)CC[C@@H]4[C@@H](/C=C/CC(C)C)C)C |
| InChI | 1S/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h6,8-10,18-19,21,23-25,28H,7,11-17H2,1-5H3/b8-6+/t19-,21+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | RQOCXCFLRBRBCS-LNOGQBHPSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.205°C at 760 mmHg (Cal.) |
| Flash point | 211.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7,22-Cholestatrien-3beta-Ol |