Online Database of Chemicals from Around the World
|
CAS#: 19690-31-4 Product: 5,6-Dichloro-2-(Trifluoromethyl)-1H-Benzimidazol-4-Ol No suppilers available for the product. |
| Name | 5,6-Dichloro-2-(Trifluoromethyl)-1H-Benzimidazol-4-Ol |
|---|---|
| Synonyms | 5,6-Dichloro-2-(Trifluoromethyl)Benzimidazol-4-Ol; Benzimidazol-4-Ol, 5,6-Dichloro-2-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C8H3Cl2F3N2O |
| Molecular Weight | 271.03 |
| CAS Registry Number | 19690-31-4 |
| SMILES | C1=C(C(=C(O)C2=C1[NH]C(=N2)C(F)(F)F)Cl)Cl |
| InChI | 1S/C8H3Cl2F3N2O/c9-2-1-3-5(6(16)4(2)10)15-7(14-3)8(11,12)13/h1,16H,(H,14,15) |
| InChIKey | WVLSHVZSPKMARB-UHFFFAOYSA-N |
| Density | 1.796g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.104°C at 760 mmHg (Cal.) |
| Flash point | 183.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dichloro-2-(Trifluoromethyl)-1H-Benzimidazol-4-Ol |