|
CAS#: 19721-74-5 Product: Bis(1,2-Dichloroethyl) Sulfone No suppilers available for the product. |
| Name | Bis(1,2-Dichloroethyl) Sulfone |
|---|---|
| Synonyms | Bis(1,2-Dichloroethyl)Sulfone; Sulfone, Bis(1,2-Dichloroethyl); 3-01-00-02680 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6Cl4O2S |
| Molecular Weight | 259.96 |
| CAS Registry Number | 19721-74-5 |
| SMILES | C(C([S](C(Cl)CCl)(=O)=O)Cl)Cl |
| InChI | 1S/C4H6Cl4O2S/c5-1-3(7)11(9,10)4(8)2-6/h3-4H,1-2H2 |
| InChIKey | QTJJOZORJHAYSE-UHFFFAOYSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.36°C at 760 mmHg (Cal.) |
| Flash point | 177.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1,2-Dichloroethyl) Sulfone |