|
CAS#: 19768-73-1 Product: 3-[Bis(2-Chloroethyl)Amino]-4-Methylbenzamide No suppilers available for the product. |
| Name | 3-[Bis(2-Chloroethyl)Amino]-4-Methylbenzamide |
|---|---|
| Synonyms | 3-[Bis(2-Chloroethyl)Amino]-4-Methyl-Benzamide; Brn 3098876; P-Toluamide, 3-(Bis(2-Chloroethyl)Amino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 |
| CAS Registry Number | 19768-73-1 |
| SMILES | C1=CC(=CC(=C1C)N(CCCl)CCCl)C(N)=O |
| InChI | 1S/C12H16Cl2N2O/c1-9-2-3-10(12(15)17)8-11(9)16(6-4-13)7-5-14/h2-3,8H,4-7H2,1H3,(H2,15,17) |
| InChIKey | JEPNDMLVRFWZTG-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.986°C at 760 mmHg (Cal.) |
| Flash point | 195.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[Bis(2-Chloroethyl)Amino]-4-Methylbenzamide |