|
CAS#: 197778-15-7 Product: Methyl (1R,2S)-1-Amino-2-Phenylcyclopropanecarboxylate No suppilers available for the product. |
| Name | Methyl (1R,2S)-1-Amino-2-Phenylcyclopropanecarboxylate |
|---|---|
| Synonyms | (1R,2S)-methyl 1-amino-2-phenylcyclopropanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 |
| CAS Registry Number | 197778-15-7 |
| SMILES | COC(=O)[C@]1(C[C@H]1c2ccccc2)N |
| InChI | 1S/C11H13NO2/c1-14-10(13)11(12)7-9(11)8-5-3-2-4-6-8/h2-6,9H,7,12H2,1H3/t9-,11+/m0/s1 |
| InChIKey | SSNHIYGBNLNDBQ-GXSJLCMTSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.852°C at 760 mmHg (Cal.) |
| Flash point | 139.069°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2S)-1-Amino-2-Phenylcyclopropanecarboxylate |