|
CAS#: 19788-60-4 Product: 2-Cyano-1-Ethoxy-1-Oxo-2-Hexanyl Benzoate No suppilers available for the product. |
| Name | 2-Cyano-1-Ethoxy-1-Oxo-2-Hexanyl Benzoate |
|---|---|
| Synonyms | 1-Cyano-1-(ethoxycarbonyl)pentyl benzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 |
| CAS Registry Number | 19788-60-4 |
| SMILES | N#CC(OC(=O)c1ccccc1)(C(=O)OCC)CCCC |
| InChI | 1S/C16H19NO4/c1-3-5-11-16(12-17,15(19)20-4-2)21-14(18)13-9-7-6-8-10-13/h6-10H,3-5,11H2,1-2H3 |
| InChIKey | CWHLGKBVELSITM-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.477°C at 760 mmHg (Cal.) |
| Flash point | 197.336°C (Cal.) |
| Refractive index | 1.511 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyano-1-Ethoxy-1-Oxo-2-Hexanyl Benzoate |