|
CAS#: 198-46-9 Product: Benzo(de)Cyclopent(a)Anthracene No suppilers available for the product. |
| Name | Benzo(de)Cyclopent(a)Anthracene |
|---|---|
| Synonyms | Delta(Sup 3)-Dehydro-3,4-Trimethyleneisobenzanthrene-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.31 |
| CAS Registry Number | 198-46-9 |
| SMILES | C5=C4C1=C3C(=CC=C1)C=C2C(=CC=C2)C3=CC4=CC=C5 |
| InChI | 1S/C20H12/c1-2-8-16-14(5-1)12-19-17-9-3-6-13(17)11-15-7-4-10-18(16)20(15)19/h1-12H |
| InChIKey | FZPMEKAWJMWZAT-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.113°C at 760 mmHg (Cal.) |
| Flash point | 282.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(de)Cyclopent(a)Anthracene |