|
CAS#: 1980-93-4 Product: 4-[2-(3,3-Dimethyl-3H-Indol-2-Yl)Ethenyl]Phenol No suppilers available for the product. |
| Name | 4-[2-(3,3-Dimethyl-3H-Indol-2-Yl)Ethenyl]Phenol |
|---|---|
| Synonyms | 4-[2-(3,3-Dimethyl-1H-Indol-2-Ylidene)Ethylidene]Cyclohexa-2,5-Dien-1-One; 4-[(2Z)-2-(3,3-Dimethylindolin-2-Ylidene)Ethylidene]Cyclohexa-2,5-Dien-1-One; 4-[2-(3,3-Dimethylindolin-2-Ylidene)Ethylidene]Cyclohexa-2,5-Dien-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 |
| CAS Registry Number | 1980-93-4 |
| SMILES | C2=C1C(\C(NC1=CC=C2)=C\C=C3C=CC(=O)C=C3)(C)C |
| InChI | 1S/C18H17NO/c1-18(2)15-5-3-4-6-16(15)19-17(18)12-9-13-7-10-14(20)11-8-13/h3-12,19H,1-2H3/b17-12- |
| InChIKey | ZBDWOHPDCDKXPK-ATVHPVEESA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.05°C at 760 mmHg (Cal.) |
| Flash point | 152.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(3,3-Dimethyl-3H-Indol-2-Yl)Ethenyl]Phenol |