Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Dr. Silviu Pharmachem Pvt. Ltd | India | Inquire | ||
|---|---|---|---|---|
|
+91 (20) 6510-4672 | |||
|
anil.bhise@silviupharmachem.com | |||
| Chemical manufacturer | ||||
| Name | 6-Chloro-1-Methyl-1H-Benzimidazole 3-Oxide |
|---|---|
| Synonyms | 6-chloro-1-methyl-1H-benzo[d]imidazole 3-oxide |
| Molecular Structure |  |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 |
| CAS Registry Number | 19808-68-5 |
| SMILES | Cn1c[n+](c2c1cc(cc2)Cl)[O-] |
| InChI | 1S/C8H7ClN2O/c1-10-5-11(12)7-3-2-6(9)4-8(7)10/h2-5H,1H3 |
| InChIKey | ZNMVMEZEIKIMED-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.701°C at 760 mmHg (Cal.) |
| Flash point | 162.875°C (Cal.) |
| Refractive index | 1.642 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1-Methyl-1H-Benzimidazole 3-Oxide |