| ChemPacific Corp | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Phenyl{4-[(Trimethylsilyl)Methyl]Phenyl}Methanone |
|---|---|
| Synonyms | enyl)-methanone; Phenyl-(4-trimethylsilanylmethyl-ph |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20OSi |
| Molecular Weight | 268.43 |
| CAS Registry Number | 1983-50-2 |
| SMILES | C[Si](C)(C)Cc1ccc(cc1)C(=O)c2ccccc2 |
| InChI | 1S/C17H20OSi/c1-19(2,3)13-14-9-11-16(12-10-14)17(18)15-7-5-4-6-8-15/h4-12H,13H2,1-3H3 |
| InChIKey | RGABWMFCXACXQH-UHFFFAOYSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.434°C at 760 mmHg (Cal.) |
| Flash point | 170.575°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| (1) | Ortwin Brede and Sergej Naumov. Free electron transfer—relations between molecule dynamics and reaction kinetics, Chem. Soc. Rev., 2010, 39, 3057. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenyl{4-[(Trimethylsilyl)Methyl]Phenyl}Methanone |