|
CAS#: 19832-26-9 Product: 1,3-Dimethyl-3-(M-Methoxyphenyl)Azetidine No suppilers available for the product. |
| Name | 1,3-Dimethyl-3-(M-Methoxyphenyl)Azetidine |
|---|---|
| Synonyms | 3-(3-Methoxyphenyl)-1,3-Dimethyl-Azetidine; 1,3-Dimethyl-3-(M-Methoxyphenyl)Azetidine; Azetidine, 1,3-Dimethyl-3-(M-Methoxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 |
| CAS Registry Number | 19832-26-9 |
| SMILES | C2=C(C1(CN(C1)C)C)C=CC=C2OC |
| InChI | 1S/C12H17NO/c1-12(8-13(2)9-12)10-5-4-6-11(7-10)14-3/h4-7H,8-9H2,1-3H3 |
| InChIKey | BBKZHHVTZDNSHC-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.415°C at 760 mmHg (Cal.) |
| Flash point | 80.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-3-(M-Methoxyphenyl)Azetidine |