Online Database of Chemicals from Around the World
|
CAS#: 19878-61-6 Product: 2,5-Bis[(1,1,3,3-Tetramethylbutyl)Dithio]-1,3,4-Thiadiazole No suppilers available for the product. |
| Name | 2,5-Bis[(1,1,3,3-Tetramethylbutyl)Dithio]-1,3,4-Thiadiazole |
|---|---|
| Synonyms | 2,5-Bis(1,1,3,3-Tetramethylbutyldisulfanyl)-1,3,4-Thiadiazole; 2,5-Bis((1,1,3,3-Tetramethylbutyl)Dithio)-1,3,4-Thiadiazole |
| Molecular Structure | ![CAS#: 19878-61-6, 2,5-Bis[(1,1,3,3-Tetramethylbutyl)Dithio]-1,3,4-Thiadiazole](/moreStructures/19878-61-6.gif) |
| Molecular Formula | C18H34N2S5 |
| Molecular Weight | 438.78 |
| CAS Registry Number | 19878-61-6 |
| EINECS | 243-389-4 |
| SMILES | C(C(SSC1=NN=C(S1)SSC(CC(C)(C)C)(C)C)(C)C)C(C)(C)C |
| InChI | 1S/C18H34N2S5/c1-15(2,3)11-17(7,8)24-22-13-19-20-14(21-13)23-25-18(9,10)12-16(4,5)6/h11-12H2,1-10H3 |
| InChIKey | LRYZVOQZDMSPCB-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.112°C at 760 mmHg (Cal.) |
| Flash point | 266.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis[(1,1,3,3-Tetramethylbutyl)Dithio]-1,3,4-Thiadiazole |