|
CAS#: 19890-63-2 Product: 19-Fluoroandrost-4-Ene-3,17-Dione No suppilers available for the product. |
| Name | 19-Fluoroandrost-4-Ene-3,17-Dione |
|---|---|
| Synonyms | (8S,9S,10S,13S,14S)-10-(Fluoromethyl)-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; 19-Fad; 19-Fluoroandrost-4-Ene-3,17-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.40 |
| CAS Registry Number | 19890-63-2 |
| SMILES | [C@@H]23CCC1=CC(CC[C@@]1([C@H]2CC[C@]4([C@H]3CCC4=O)C)CF)=O |
| InChI | 1S/C19H25FO2/c1-18-8-7-16-14(15(18)4-5-17(18)22)3-2-12-10-13(21)6-9-19(12,16)11-20/h10,14-16H,2-9,11H2,1H3/t14-,15-,16-,18-,19+/m0/s1 |
| InChIKey | AOJSNVYXFKSKGH-BGJMDTOESA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.209°C at 760 mmHg (Cal.) |
| Flash point | 169.646°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Fluoroandrost-4-Ene-3,17-Dione |