|
CAS#: 19902-26-2 Product: (4beta)-Cedr-8(15)-en-4-ol No suppilers available for the product. |
| Name | (4beta)-Cedr-8(15)-en-4-ol |
|---|---|
| Synonyms | β-biotol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 19902-26-2 |
| SMILES | C=C1CC[C@]23C[C@@H]1C(C)(C)[C@@H]3[C@@H](O)C[C@H]2C |
| InChI | 1S/C15H24O/c1-9-5-6-15-8-11(9)14(3,4)13(15)12(16)7-10(15)2/h10-13,16H,1,5-8H2,2-4H3/t10-,11+,12+,13+,15+/m1/s1 |
| InChIKey | XXEZIFFYVUWPSP-MCZMQQNQSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.97°C at 760 mmHg (Cal.) |
| Flash point | 126.76°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4beta)-Cedr-8(15)-en-4-ol |