Online Database of Chemicals from Around the World
|
CAS#: 199594-82-6 Product: 1-[(2,6-Difluorophenyl)Methyl]-4-Methylbenzimidazole No suppilers available for the product. |
| Name | 1-[(2,6-Difluorophenyl)Methyl]-4-Methylbenzimidazole |
|---|---|
| Synonyms | 1-[(2,6-Difluorophenyl)Methyl]-4-Methyl-Benzimidazole; 1-(2,6-Difluorobenzyl)-4-Methyl-Benzimidazole; Aids058863 |
| Molecular Structure | ![CAS#: 199594-82-6, 1-[(2,6-Difluorophenyl)Methyl]-4-Methylbenzimidazole](/moreStructures/199594-82-6.gif) |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 199594-82-6 |
| SMILES | C2=NC1=C(C=CC=C1[N]2CC3=C(F)C=CC=C3F)C |
| InChI | 1S/C15H12F2N2/c1-10-4-2-7-14-15(10)18-9-19(14)8-11-12(16)5-3-6-13(11)17/h2-7,9H,8H2,1H3 |
| InChIKey | VPEWBYMJUVSDBS-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.849°C at 760 mmHg (Cal.) |
| Flash point | 194.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2,6-Difluorophenyl)Methyl]-4-Methylbenzimidazole |