|
CAS#: 19990-26-2 Product: 5-(Phenylimino)Furan-2(5H)-One No suppilers available for the product. |
| Name | 5-(Phenylimino)Furan-2(5H)-One |
|---|---|
| Synonyms | 5-Phenylimino-2-Furanone; 2(5H)-Furanone, 5-(Phenylimino)-; Acrylic Acid, 3-(1-Hydroxy-N-Phenylformimidoyl)-, Cyclic Anhydride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 19990-26-2 |
| SMILES | C1=CC=C(C=C1)N=C2C=CC(=O)O2 |
| InChI | 1S/C10H7NO2/c12-10-7-6-9(13-10)11-8-4-2-1-3-5-8/h1-7H |
| InChIKey | NULZNTDKTDTWGL-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.913°C at 760 mmHg (Cal.) |
| Flash point | 138.368°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Phenylimino)Furan-2(5H)-One |