Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-[5-(Dimethylamino)-2-Methoxyphenyl]Sulfuric Diamide |
|---|---|
| Molecular Structure | ![CAS#: 200511-17-7, N-[5-(Dimethylamino)-2-Methoxyphenyl]Sulfuric Diamide](/moreStructures/200511-17-7.gif) |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 |
| CAS Registry Number | 200511-17-7 |
| SMILES | CN(C)c1ccc(c(c1)NS(=O)(=O)N)OC |
| InChI | 1S/C9H15N3O3S/c1-12(2)7-4-5-9(15-3)8(6-7)11-16(10,13)14/h4-6,11H,1-3H3,(H2,10,13,14) |
| InChIKey | YUVMQVQPITWQNM-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.245°C at 760 mmHg (Cal.) |
| Flash point | 220.657°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[5-(Dimethylamino)-2-Methoxyphenyl]Sulfuric Diamide |