|
CAS#: 20057-16-3 Product: 5,10-Dihydro-5-Methylphenazine No suppilers available for the product. |
| Name | 5,10-Dihydro-5-Methylphenazine |
|---|---|
| Synonyms | 5,10-Dihydro-5-Methylphenazine; Phenazine, 5,10-Dihydro-5-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 20057-16-3 |
| SMILES | C1=CC=C2C(=C1)N(C3=C(N2)C=CC=C3)C |
| InChI | 1S/C13H12N2/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15/h2-9,14H,1H3 |
| InChIKey | XZPNVGKRRGOOMS-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.528°C at 760 mmHg (Cal.) |
| Flash point | 169.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,10-Dihydro-5-Methylphenazine |