|
CAS#: 20069-02-7 Product: 1-Methyl-4-[(2S)-1-Methyl-2alpha-Pyrrolidinyl]-beta-Carboline No suppilers available for the product. |
| Name | 1-Methyl-4-[(2S)-1-Methyl-2alpha-Pyrrolidinyl]-beta-Carboline |
|---|---|
| Synonyms | 1-Methyl-4-[(2S)-1-Methyl-2-Pyrrolidinyl]-9H-Pyrido[3,4-B]Indole; 1-Methyl-4-[(2S)-1-Methylpyrrolidin-2-Yl]-9H-$B-Carboline; Brevicolline |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 |
| CAS Registry Number | 20069-02-7 |
| SMILES | [C@H]4(C1=CN=C(C3=C1C2=C(C=CC=C2)[NH]3)C)N(CCC4)C |
| InChI | 1S/C17H19N3/c1-11-17-16(12-6-3-4-7-14(12)19-17)13(10-18-11)15-8-5-9-20(15)2/h3-4,6-7,10,15,19H,5,8-9H2,1-2H3/t15-/m0/s1 |
| InChIKey | DIZAFWUMCZPYGF-HNNXBMFYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.415°C at 760 mmHg (Cal.) |
| Flash point | 231.646°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-[(2S)-1-Methyl-2alpha-Pyrrolidinyl]-beta-Carboline |