|
CAS#: 20103-92-8 Product: 1-Phenyl-3-(1-Pyrrolidinyl)-1,3-Propanedione No suppilers available for the product. |
| Name | 1-Phenyl-3-(1-Pyrrolidinyl)-1,3-Propanedione |
|---|---|
| Synonyms | 3-Oxo-1-phenyl-3-(1-pyrrolidinyl)-1-propanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26 |
| CAS Registry Number | 20103-92-8 |
| SMILES | O=C(N1CCCC1)CC(=O)c2ccccc2 |
| InChI | 1S/C13H15NO2/c15-12(11-6-2-1-3-7-11)10-13(16)14-8-4-5-9-14/h1-3,6-7H,4-5,8-10H2 |
| InChIKey | YXQRHIPHCIQPPT-UHFFFAOYSA-N |
| Density | 1.162g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.028°C at 760 mmHg (Cal.) |
| Flash point | 189.05°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-3-(1-Pyrrolidinyl)-1,3-Propanedione |