|
CAS#: 2012-21-7 Product: 2,4-Bis[(E)-2-Phenylethenyl]Phenol No suppilers available for the product. |
| Name | 2,4-Bis[(E)-2-Phenylethenyl]Phenol |
|---|---|
| Synonyms | 2,4-Bis(2-Phenylethenyl)Phenol; 2,4-Bis[(E)-2-Phenylvinyl]Phenol; 2,4-Bis(2-Phenylvinyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18O |
| Molecular Weight | 298.38 |
| CAS Registry Number | 2012-21-7 |
| EINECS | 217-933-6 |
| SMILES | C1=C(C(=CC=C1\C=C\C2=CC=CC=C2)O)\C=C\C3=CC=CC=C3 |
| InChI | 1S/C22H18O/c23-22-16-14-20(12-11-18-7-3-1-4-8-18)17-21(22)15-13-19-9-5-2-6-10-19/h1-17,23H/b12-11+,15-13+ |
| InChIKey | CRPRNPDCERQCDS-NOVYJZLUSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.211°C at 760 mmHg (Cal.) |
| Flash point | 224.418°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis[(E)-2-Phenylethenyl]Phenol |