|
CAS#: 20165-81-5 Product: Diethyl Dichloromalonate No suppilers available for the product. |
| Name | Diethyl Dichloromalonate |
|---|---|
| Synonyms | 2,2-Dichloropropanedioic Acid Diethyl Ester; 2,2-Dichloromalonic Acid Diethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10Cl2O4 |
| Molecular Weight | 229.06 |
| CAS Registry Number | 20165-81-5 |
| EINECS | 243-550-9 |
| SMILES | C(OC(C(C(OCC)=O)(Cl)Cl)=O)C |
| InChI | 1S/C7H10Cl2O4/c1-3-12-5(10)7(8,9)6(11)13-4-2/h3-4H2,1-2H3 |
| InChIKey | QVRUXRSUYSWFJN-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.023°C at 760 mmHg (Cal.) |
| Flash point | 84.989°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl Dichloromalonate |