|
CAS#: 20177-84-8 Product: 2,2'-Sulfanediylbis[1-(4-Methoxyphenyl)Ethanone] No suppilers available for the product. |
| Name | 2,2'-Sulfanediylbis[1-(4-Methoxyphenyl)Ethanone] |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.40 |
| CAS Registry Number | 20177-84-8 |
| SMILES | O=C(c1ccc(OC)cc1)CSCC(=O)c2ccc(OC)cc2 |
| InChI | 1S/C18H18O4S/c1-21-15-7-3-13(4-8-15)17(19)11-23-12-18(20)14-5-9-16(22-2)10-6-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | YUUJHRITZYUZIP-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.425°C at 760 mmHg (Cal.) |
| Flash point | 266.05°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Sulfanediylbis[1-(4-Methoxyphenyl)Ethanone] |