|
CAS#: 20223-80-7 Product: L-beta-Aspartyl-L-Histidine No suppilers available for the product. |
| Name | L-beta-Aspartyl-L-Histidine |
|---|---|
| Synonyms | BDH; H-ASP(HIS-OH)-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 20223-80-7 |
| SMILES | O=C(O)[C@@H](N)CC(=O)N[C@H](C(=O)O)Cc1cncn1 |
| InChI | 1S/C10H14N4O5/c11-6(9(16)17)2-8(15)14-7(10(18)19)1-5-3-12-4-13-5/h3-4,6-7H,1-2,11H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)/t6-,7-/m0/s1 |
| InChIKey | KABYBYFUSGXITA-BQBZGAKWSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 764.548°C at 760 mmHg (Cal.) |
| Flash point | 416.184°C (Cal.) |
| Refractive index | 1.619 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-beta-Aspartyl-L-Histidine |