|
CAS#: 20244-55-7 Product: 2,4,4,6-Tetrachloro-2,5-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 2,4,4,6-Tetrachloro-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | 2,4,4,6-Tetrachloro-1-Cyclohexa-2,5-Dienone |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl4O |
| Molecular Weight | 231.89 |
| CAS Registry Number | 20244-55-7 |
| SMILES | O=C1C(=CC(C=C1Cl)(Cl)Cl)Cl |
| InChI | 1S/C6H2Cl4O/c7-3-1-6(9,10)2-4(8)5(3)11/h1-2H |
| InChIKey | PCZOCOUKAYTNJX-UHFFFAOYSA-N |
| Density | 1.661g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.989°C at 760 mmHg (Cal.) |
| Flash point | 147.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,4,6-Tetrachloro-2,5-Cyclohexadien-1-One |