|
CAS#: 20286-18-4 Product: 1-(3-Chlorobenzoyl)Aziridine No suppilers available for the product. |
| Name | 1-(3-Chlorobenzoyl)Aziridine |
|---|---|
| Synonyms | 1-Aziridinyl-(3-Chlorophenyl)Methanone; (3-Chlorophenyl)-Ethylenimino-Methanone; 1-(M-Chlorobenzoyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 |
| CAS Registry Number | 20286-18-4 |
| SMILES | C2=C(C(N1CC1)=O)C=CC=C2Cl |
| InChI | 1S/C9H8ClNO/c10-8-3-1-2-7(6-8)9(12)11-4-5-11/h1-3,6H,4-5H2 |
| InChIKey | IYEBEDIAZWVYRR-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.428°C at 760 mmHg (Cal.) |
| Flash point | 148.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Chlorobenzoyl)Aziridine |