| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Morphine-3-beta-D-glucuronide |
| Synonyms | Morphine-3-Glucuronide; Beta-D-Glucopyranosiduronic Acid, (5Alpha,6Alpha)-7,8-Didehydro-4,5-Epoxy-6-Hydroxy-17-Methylmorphinan-3-Yl |
| Molecular Structure | ![]() |
| Molecular Formula | C23H27NO9 |
| Molecular Weight | 461.47 |
| CAS Registry Number | 20290-09-9 |
| SMILES | [C@]235C1=C4C=CC(=C1O[C@H]2[C@H](C=C[C@H]3[C@@H](C4)N(CC5)C)O)O[C@@H]6O[C@@H]([C@@H](O)[C@@H]([C@H]6O)O)C(=O)O |
| InChI | 1S/C23H27NO9/c1-24-7-6-23-10-3-4-12(25)20(23)32-18-13(5-2-9(14(18)23)8-11(10)24)31-22-17(28)15(26)16(27)19(33-22)21(29)30/h2-5,10-12,15-17,19-20,22,25-28H,6-8H2,1H3,(H,29,30)/t10-,11+,12-,15-,16-,17+,19-,20-,22+,23-/m0/s1 |
| InChIKey | WAEXKFONHRHFBZ-ZXDZBKESSA-N |
| Density | 1.65g/cm3 (Cal.) |
|---|---|
| Boiling point | 745.069°C at 760 mmHg (Cal.) |
| Flash point | 404.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Morphine-3-beta-D-glucuronide |