|
CAS#: 2030-45-7 Product: 2-Benzoyl-1-Benzofuran-3(2H)-One No suppilers available for the product. |
| Name | 2-Benzoyl-1-Benzofuran-3(2H)-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 2030-45-7 |
| SMILES | O=C1c3ccccc3OC1C(=O)c2ccccc2 |
| InChI | 1S/C15H10O3/c16-13(10-6-2-1-3-7-10)15-14(17)11-8-4-5-9-12(11)18-15/h1-9,15H |
| InChIKey | VBNSWPNEAASVDK-UHFFFAOYSA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.02°C at 760 mmHg (Cal.) |
| Flash point | 187.613°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Benzoyl-1-Benzofuran-3(2H)-One |