Online Database of Chemicals from Around the World
|
CAS#: 20301-63-7 Product: Thiometon-Sulfone No suppilers available for the product. |
| Name | Thiometon-Sulfone |
|---|---|
| Synonyms | 2-Ethylsulfonylethylsulfanyl-Dimethoxy-Thioxo-Phosphorane; (2-Ethylsulfonylethylthio)-Dimethoxy-Thioxophosphorane; (2-Ethylsulfonylethylthio)-Dimethoxy-Thioxo-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C6H15O4PS3 |
| Molecular Weight | 278.34 |
| CAS Registry Number | 20301-63-7 |
| SMILES | C(S[P](=S)(OC)OC)C[S](=O)(=O)CC |
| InChI | 1S/C6H15O4PS3/c1-4-14(7,8)6-5-13-11(12,9-2)10-3/h4-6H2,1-3H3 |
| InChIKey | GAXMYYJSILFZLT-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.882°C at 760 mmHg (Cal.) |
| Flash point | 195.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiometon-Sulfone |