Online Database of Chemicals from Around the World
|
CAS#: 20327-68-8 Product: 2-(Methylamino)-9,10-Anthraquinone No suppilers available for the product. |
| Name | 2-(Methylamino)-9,10-Anthraquinone |
|---|---|
| Synonyms | 2-(Methylamino)-9,10-anthracenedione; 2-(Methylamino)anthraquinone; 2-Methylaminoanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25 |
| CAS Registry Number | 20327-68-8 |
| SMILES | CNc2ccc3C(=O)c1ccccc1C(=O)c3c2 |
| InChI | 1S/C15H11NO2/c1-16-9-6-7-12-13(8-9)15(18)11-5-3-2-4-10(11)14(12)17/h2-8,16H,1H3 |
| InChIKey | GDVSGAURQOZZGU-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.184°C at 760 mmHg (Cal.) |
| Flash point | 195.763°C (Cal.) |
| Refractive index | 1.691 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Methylamino)-9,10-Anthraquinone |