|
CAS#: 20349-42-2 Product: 2-(2-Tert-Butyl-5-Methylphenoxy)Aniline No suppilers available for the product. |
| Name | 2-(2-Tert-Butyl-5-Methylphenoxy)Aniline |
|---|---|
| Synonyms | 2-(2-Tert-Butyl-5-Methyl-Phenoxy)Aniline; [2-(2-Tert-Butyl-5-Methyl-Phenoxy)Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 |
| CAS Registry Number | 20349-42-2 |
| EINECS | 243-755-3 |
| SMILES | C1=C(C(=CC=C1)N)OC2=CC(=CC=C2C(C)(C)C)C |
| InChI | 1S/C17H21NO/c1-12-9-10-13(17(2,3)4)16(11-12)19-15-8-6-5-7-14(15)18/h5-11H,18H2,1-4H3 |
| InChIKey | XOQCIBMHBHDBQP-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.301°C at 760 mmHg (Cal.) |
| Flash point | 147.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Tert-Butyl-5-Methylphenoxy)Aniline |