| Interbioscreen Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | (4R)-4-Isopropenyl-1-Methyl-7-Oxabicyclo[4.1.0]Heptane |
|---|---|
| Synonyms | (+)-Limonene oxide; (+)-Limonene oxide, mixture of cis and trans; (4R)-1,2-Epoxy-p-menth-8-ene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.23 |
| CAS Registry Number | 203719-54-4 |
| SMILES | O1C2(C)CC[C@@H](/C(=C)C)CC12 |
| InChI | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m1/s1 |
| InChIKey | CCEFMUBVSUDRLG-XNWIYYODSA-N |
| Density | 0.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 212.2664-213.4996°C (Expl.) |
| 198.145°C at 760 mmHg (Cal.) | |
| Flash point | 65.556°C (Cal.) |
| Refractive index | 1.491 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (4R)-4-Isopropenyl-1-Methyl-7-Oxabicyclo[4.1.0]Heptane |