|
CAS#: 20404-97-1 Product: N-[4-[1-[(4-Methylphenyl)Thio]-2-Nitroethyl]Phenyl]Acetamide No suppilers available for the product. |
| Name | N-[4-[1-[(4-Methylphenyl)Thio]-2-Nitroethyl]Phenyl]Acetamide |
|---|---|
| Synonyms | N-[4-[1-(4-Methylphenyl)Sulfanyl-2-Nitro-Ethyl]Phenyl]Acetamide; N-[4-[1-[(4-Methylphenyl)Thio]-2-Nitroethyl]Phenyl]Acetamide; N-[4-[1-[(4-Methylphenyl)Thio]-2-Nitro-Ethyl]Phenyl]Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.40 |
| CAS Registry Number | 20404-97-1 |
| SMILES | C2=C(C(SC1=CC=C(C)C=C1)C[N+]([O-])=O)C=CC(=C2)NC(C)=O |
| InChI | 1S/C17H18N2O3S/c1-12-3-9-16(10-4-12)23-17(11-19(21)22)14-5-7-15(8-6-14)18-13(2)20/h3-10,17H,11H2,1-2H3,(H,18,20) |
| InChIKey | FEYDRETXYFWGJR-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.478°C at 760 mmHg (Cal.) |
| Flash point | 287.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-[1-[(4-Methylphenyl)Thio]-2-Nitroethyl]Phenyl]Acetamide |