| Name | (1,2-Dibromo-2-Phenylethenyl)Benzene |
|---|---|
| Synonyms | [(E)-1,2-Dibromo-2-Phenylethenyl]Benzene; (1,2-Dibromo-2-Phenyl-Vinyl)Benzene; [(E)-1,2-Dibromo-2-Phenyl-Vinyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Br2 |
| Molecular Weight | 338.04 |
| CAS Registry Number | 20432-10-4 |
| SMILES | C1=CC=CC=C1\C(=C(\C2=CC=CC=C2)Br)Br |
| InChI | 1S/C14H10Br2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H/b14-13+ |
| InChIKey | XNJYRGMCZCPTJE-BUHFOSPRSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.033°C at 760 mmHg (Cal.) |
| Flash point | 204.529°C (Cal.) |
| (1) | Ajda Podgoršek, Marco Eissen, Jens Fleckenstein, Stojan Stavber, Marko Zupan and Jernej Iskra. Selective aerobic oxidative dibromination of alkenes with aqueous HBr and sodium nitrite as a catalyst, Green Chem., 2009, 11, 120. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1,2-Dibromo-2-Phenylethenyl)Benzene |