Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Amino-4-Nitro-2-Thiophenecarboxylic Acid |
|---|---|
| Synonyms | 5-amino-4-nitrothiophene-2-carboxylic acid; NSC109371 |
| Molecular Structure |  |
| Molecular Formula | C5H4N2O4S |
| Molecular Weight | 188.16 |
| CAS Registry Number | 204326-36-3 |
| SMILES | O=[N+]([O-])c1cc(sc1N)C(=O)O |
| InChI | 1S/C5H4N2O4S/c6-4-2(7(10)11)1-3(12-4)5(8)9/h1H,6H2,(H,8,9) |
| InChIKey | ZIOABGTXZUUIAD-UHFFFAOYSA-N |
| Density | 1.782g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.843°C at 760 mmHg (Cal.) |
| Flash point | 244.605°C (Cal.) |
| Refractive index | 1.735 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-4-Nitro-2-Thiophenecarboxylic Acid |