|
CAS#: 20450-76-4 Product: Phthalic Acid, Ammonium Salt No suppilers available for the product. |
| Name | Phthalic Acid, Ammonium Salt |
|---|---|
| Synonyms | Phthalic Acid, Ammonium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 |
| CAS Registry Number | 20450-76-4 |
| EINECS | 243-830-0 |
| SMILES | C1=CC=CC(=C1C(O)=O)C(=O)O.N |
| InChI | 1S/C8H6O4.H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);1H3 |
| InChIKey | OSKNUZYLXFBIHL-UHFFFAOYSA-N |
| Boiling point | 378.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phthalic Acid, Ammonium Salt |