|
CAS#: 204512-89-0 Product: 9-Pentofuranosyl-N-(Tetrahydro-3-Furanyl)-9H-Purin-6-Amine No suppilers available for the product. |
| Name | 9-Pentofuranosyl-N-(Tetrahydro-3-Furanyl)-9H-Purin-6-Amine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H19N5O5 |
| Molecular Weight | 337.33 |
| CAS Registry Number | 204512-89-0 |
| SMILES | c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CO)O)O)NC4CCOC4 |
| InChI | 1S/C14H19N5O5/c20-3-8-10(21)11(22)14(24-8)19-6-17-9-12(15-5-16-13(9)19)18-7-1-2-23-4-7/h5-8,10-11,14,20-22H,1-4H2,(H,15,16,18) |
| InChIKey | OESBDSFYJMDRJY-UHFFFAOYSA-N |
| Density | 1.891g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.935°C at 760 mmHg (Cal.) |
| Flash point | 380.131°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Pentofuranosyl-N-(Tetrahydro-3-Furanyl)-9H-Purin-6-Amine |