|
CAS#: 20483-36-7 Product: 4-(2,6,6-Trimethyl-1,3-Cyclohexadien-1-Yl)Butan-2-One No suppilers available for the product. |
| Name | 4-(2,6,6-Trimethyl-1,3-Cyclohexadien-1-Yl)Butan-2-One |
|---|---|
| Synonyms | 2-Butanone, 4-(2,6,6-Trimethyl-1,3-Cyclohexadien-1-Yl)-; 4-(2,6,6-Trimethyl-1,3-Cyclohexadien-1-Yl)-2-Butanone; 4-(2,6,6-Trimethyl-1,3-Cyclohexadien-1-Yl)Butan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 20483-36-7 |
| EINECS | 243-847-3 |
| FEMA | 3447 |
| SMILES | C(C1=C(C=CCC1(C)C)C)CC(=O)C |
| InChI | 1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h5-6H,7-9H2,1-4H3 |
| InChIKey | SQFRYZPEWOZAKJ-UHFFFAOYSA-N |
| Density | 0.894g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.425°C at 760 mmHg (Cal.) |
| Flash point | 95.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,6,6-Trimethyl-1,3-Cyclohexadien-1-Yl)Butan-2-One |