|
CAS#: 204990-17-0 Product: (3aR,7aR)-1,3-Dimethyl-N-[(1S)-1-Phenylethyl]Octahydro-1H-1,3,2-Benzodiazaphosphol-2-Amine 2-Oxide No suppilers available for the product. |
| Name | (3aR,7aR)-1,3-Dimethyl-N-[(1S)-1-Phenylethyl]Octahydro-1H-1,3,2-Benzodiazaphosphol-2-Amine 2-Oxide |
|---|---|
| Synonyms | (3a,7aR)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26N3OP |
| Molecular Weight | 307.37 |
| CAS Registry Number | 204990-17-0 |
| SMILES | CC(c1ccccc1)NP2(=O)N(C3CCCCC3N2C)C |
| InChI | 1S/C16H26N3OP/c1-13(14-9-5-4-6-10-14)17-21(20)18(2)15-11-7-8-12-16(15)19(21)3/h4-6,9-10,13,15-16H,7-8,11-12H2,1-3H3,(H,17,20)/t13-,15+,16+/m0/s1 |
| InChIKey | NEVIAYVVEZMXAO-NUEKZKHPSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.331°C at 760 mmHg (Cal.) |
| Flash point | 205.59°C (Cal.) |
| Refractive index | 1.572 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3aR,7aR)-1,3-Dimethyl-N-[(1S)-1-Phenylethyl]Octahydro-1H-1,3,2-Benzodiazaphosphol-2-Amine 2-Oxide |