Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(Isobutyrylamino)Methyl]Cyclopropanecarboxylic Acid |
|---|---|
| Synonyms | 1-(isobutyramidomethyl)cyclopropanecarboxylic acid |
| Molecular Structure | ![CAS#: 205173-58-6, 1-[(Isobutyrylamino)Methyl]Cyclopropanecarboxylic Acid](/moreStructures/205173-58-6.gif) |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 |
| CAS Registry Number | 205173-58-6 |
| SMILES | CC(C)C(=O)NCC1(CC1)C(=O)O |
| InChI | 1S/C9H15NO3/c1-6(2)7(11)10-5-9(3-4-9)8(12)13/h6H,3-5H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | KUTITUBSMJCIDY-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.617°C at 760 mmHg (Cal.) |
| Flash point | 196.086°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(Isobutyrylamino)Methyl]Cyclopropanecarboxylic Acid |